CAS:2923-66-2|3'-Chloro-4'-fluoroacetophenone
Molecular Formula:C8H6ClFO
Molecular Weight:172.59g/mol
Purity:97 percent
Package:100g/250g/500g/bulk package
- Piegāde visā pasaulē
- Kvalitātes nodrošināšana
- 24/7 klientu apkalpošana
Produkta ievads
3'-Chloro-4'-fluoroacetophenone(CAS:2923-66-2) has been used in a variety of scientific research applications, including drug development, biochemical and physiological studies, and synthesis of other compounds. It has been used in the synthesis of a variety of compounds, including 4-chloro-3-fluoroaniline and 3-chloro-4-fluorobenzaldehyde. It has also been used in the synthesis of pharmaceuticals, such as the anticonvulsant drug phenytoin.
|
|
|
| 1-(3-chloro-4-fluorophenyl)ethanone | |
| MFCD00042203 | |
| 252.4 degree at 760 mmHg | |
| 42 degree | |
| 126-127 degree /15mm | |
| 1.3g/cm3 | |
| 17.07 | |
| 2.68 | |
| 200mmHg at 25 degree | |
| 1.247 | |
| InChI=1S/C8H6ClFO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,1H3 | |
| PCJPESKRPOTNGU-UHFFFAOYSA-N |

Populāri tagi: cas:2923-66-2|3'-chloro-4'-fluoroacetophenone, price, quotation, discount, in stock, for sale
Jums varētu patikt arī
-

CAS:5445-51-2|Ciklobutāns-1, 1-dikarbonskābe
-

CAS:33089-37-1|1,4,7,10,13,16,19,22-oktaoksaciklotet...
-

CAS:52-51-7|2-Brom-2-nitro-1,3-propāndiols
-

CAS:113170-55-1|L-askorbīnskābe 2-(dihidrogēnfosfāts...
-

CAS:4511-42-6|L-laktīda ražotājs ar konkurētspējīgu ...
-

CAS:5744-59-2|1,5-dimetil-1H-pirazola-3-karbonskābe


